C28H26Cl2N2O5 — CID 19111719
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111719) has the molecular formula C28H26Cl2N2O5 and a molecular weight of 541.43 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111719 |
| Molecular Formula | C28H26Cl2N2O5 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CCOc1cc(/C=C2/C(=O)N(CC3CCCO3)C(=O)C(C#N)=C2C)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H26Cl2N2O5/c1-3-35-26-12-18(6-9-25(26)37-16-19-7-8-20(29)13-24(19)30)11-22-17(2)23(14-31)28(34)32(27(22)33)15-21-5-4-10-36-21/h6-9,11-13,21H,3-5,10,15-16H2,1-2H3/b22-11+ |
| InChIKey | BXKFCABRLCACLR-SSDVNMTOSA-N |
| XLogP | 5.74 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|