C30H25ClN2O4 — CID 19112002
(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 19112002) has the molecular formula C30H25ClN2O4 and a molecular weight of 512.99 g/mol. Its IUPAC name is (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112002 |
| Molecular Formula | C30H25ClN2O4 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-methyl-2,6-dioxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | COc1cc(/C=C2/C(=O)N(CCc3ccccc3)C(=O)C(C#N)=C2C)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C30H25ClN2O4/c1-20-24(29(34)33(30(35)25(20)18-32)15-14-21-8-4-3-5-9-21)16-22-12-13-27(28(17-22)36-2)37-19-23-10-6-7-11-26(23)31/h3-13,16-17H,14-15,19H2,1-2H3/b24-16+ |
| InChIKey | OSVGOEVARJAOOF-LFVJCYFKSA-N |
| XLogP | 5.76 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|