C32H23FN4O5 — CID 19112734
(5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112734) has the molecular formula C32H23FN4O5 and a molecular weight of 562.56 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112734 |
| Molecular Formula | C32H23FN4O5 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C(C#N)=C2C)cc1F |
| InChI | InChI=1S/C32H23FN4O5/c1-19-24(31(38)36(32(39)25(19)15-34)16-20-8-10-28-29(12-20)42-18-41-28)13-22-17-37(23-6-4-3-5-7-23)35-30(22)21-9-11-27(40-2)26(33)14-21/h3-14,17H,16,18H2,1-2H3/b24-13+ |
| InChIKey | BNVJHZBJHCBZNJ-ZMOGYAJESA-N |
| XLogP | 5.21 |
| TPSA | 106.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|