C26H22N2O6 — CID 19112808
(5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112808) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112808 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-5-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | C=CCOc1ccc(/C=C2/C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C(C#N)=C2C)cc1OC |
| InChI | InChI=1S/C26H22N2O6/c1-4-9-32-21-7-5-17(11-23(21)31-3)10-19-16(2)20(13-27)26(30)28(25(19)29)14-18-6-8-22-24(12-18)34-15-33-22/h4-8,10-12H,1,9,14-15H2,2-3H3/b19-10+ |
| InChIKey | NZQWNESEEQXDNT-VXLYETTFSA-N |
| XLogP | 3.78 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|