C20H17N3O4S3 — CID 19115052
6-hydroxy-1,4-dimethyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile (PubChem CID 19115052) has the molecular formula C20H17N3O4S3 and a molecular weight of 459.57 g/mol. Its IUPAC name is 6-hydroxy-1,4-dimethyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-1,4-dimethyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115052 |
| Molecular Formula | C20H17N3O4S3 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 6-hydroxy-1,4-dimethyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)CCCN2C(=O)/C(=C/c3cccs3)SC2=S)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C20H17N3O4S3/c1-11-13(10-21)17(25)22(2)19(27)16(11)14(24)6-3-7-23-18(26)15(30-20(23)28)9-12-5-4-8-29-12/h4-5,8-9,27H,3,6-7H2,1-2H3/b15-9- |
| InChIKey | HKKHLPOQPRRAHS-DHDCSXOGSA-N |
| XLogP | 3.20 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|