C17H11F5N2O4 — CID 19115160
1-ethyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile (PubChem CID 19115160) has the molecular formula C17H11F5N2O4 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-ethyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115160 |
| Molecular Formula | C17H11F5N2O4 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 1-ethyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
| SMILES | CCn1c(O)c(C(=O)COc2c(F)c(F)c(F)c(F)c2F)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C17H11F5N2O4/c1-3-24-16(26)7(4-23)6(2)9(17(24)27)8(25)5-28-15-13(21)11(19)10(18)12(20)14(15)22/h27H,3,5H2,1-2H3 |
| InChIKey | XJAAOWFRCGFFDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|