C20H28N2O3 — CID 19115177
5-(4-butylcyclohexanecarbonyl)-1-ethyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19115177) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-(4-butylcyclohexanecarbonyl)-1-ethyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(4-butylcyclohexanecarbonyl)-1-ethyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115177 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5-(4-butylcyclohexanecarbonyl)-1-ethyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCC1CCC(C(=O)c2c(C)c(C#N)c(=O)n(CC)c2O)CC1 |
| InChI | InChI=1S/C20H28N2O3/c1-4-6-7-14-8-10-15(11-9-14)18(23)17-13(3)16(12-21)19(24)22(5-2)20(17)25/h14-15,25H,4-11H2,1-3H3 |
| InChIKey | LAZHRJWVAOIRKL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |