C22H21N3O4S3 — CID 19115449
1-butyl-6-hydroxy-4-methyl-2-oxo-5-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbonitrile (PubChem CID 19115449) has the molecular formula C22H21N3O4S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-4-methyl-2-oxo-5-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-hydroxy-4-methyl-2-oxo-5-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115449 |
| Molecular Formula | C22H21N3O4S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1-butyl-6-hydroxy-4-methyl-2-oxo-5-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbonitrile |
| SMILES | CCCCn1c(O)c(C(=O)CCN2C(=O)/C(=C/c3cccs3)SC2=S)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C22H21N3O4S3/c1-3-4-8-24-19(27)15(12-23)13(2)18(21(24)29)16(26)7-9-25-20(28)17(32-22(25)30)11-14-6-5-10-31-14/h5-6,10-11,29H,3-4,7-9H2,1-2H3/b17-11- |
| InChIKey | SURDTHULKXDQDX-BOPFTXTBSA-N |
| XLogP | 4.07 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|