About disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate
disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate (PubChem CID 19116) has the molecular formula C16H11N3Na2O7S2
and a molecular weight of 467.39 g/mol. Its IUPAC name is disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate |
| PubChem CID | 19116 |
| Molecular Formula | C16H11N3Na2O7S2 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate |
| SMILES | Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(/N=N/c3ccccc3)c(O)c12.[Na+].[Na+] |
| InChI | InChI=1S/C16H13N3O7S2.2Na/c17-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)19-18-10-4-2-1-3-5-10;;/h1-8,20H,17H2,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b19-18+;; |
| InChIKey | LQJVOKWHGUAUHK-BUFQOAPZSA-L |
| XLogP | -3.64 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate?
The IUPAC name of disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate (CID 19116) is disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate.
What is the SMILES notation for disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate?
The canonical SMILES for disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate is Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(/N=N/c3ccccc3)c(O)c12.[Na+].[Na+].
What is the InChIKey of disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate?
The InChIKey is LQJVOKWHGUAUHK-BUFQOAPZSA-L. The full InChI is InChI=1S/C16H13N3O7S2.2Na/c17-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)19-18-10-4-2-1-3-5-10;;/h1-8,20H,17H2,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b19-18+;;.
What are the key properties of disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate?
disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate has a molecular weight of 467.39 g/mol, XLogP of -3.64, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate is sourced from PubChem (CID 19116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).