C18H16Cl2N2O4 — CID 19117094
5-(2,4-dichlorobenzoyl)-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19117094) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 5-(2,4-dichlorobenzoyl)-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(2,4-dichlorobenzoyl)-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117094 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-(2,4-dichlorobenzoyl)-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | COCCCn1c(O)c(C(=O)c2ccc(Cl)cc2Cl)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-10-13(9-21)17(24)22(6-3-7-26-2)18(25)15(10)16(23)12-5-4-11(19)8-14(12)20/h4-5,8,25H,3,6-7H2,1-2H3 |
| InChIKey | XGWFJDMMTNZZNO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|