C21H23ClN2O5 — CID 19117275
5-[2-(2-chlorophenoxy)propanoyl]-1-(3-ethoxypropyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19117275) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is 5-[2-(2-chlorophenoxy)propanoyl]-1-(3-ethoxypropyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[2-(2-chlorophenoxy)propanoyl]-1-(3-ethoxypropyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117275 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 5-[2-(2-chlorophenoxy)propanoyl]-1-(3-ethoxypropyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCOCCCn1c(O)c(C(=O)C(C)Oc2ccccc2Cl)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H23ClN2O5/c1-4-28-11-7-10-24-20(26)15(12-23)13(2)18(21(24)27)19(25)14(3)29-17-9-6-5-8-16(17)22/h5-6,8-9,14,27H,4,7,10-11H2,1-3H3 |
| InChIKey | IELWPMSSLYKERP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|