C22H26N2O5 — CID 19117378
6-hydroxy-4-methyl-5-[2-(3-methylphenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile (PubChem CID 19117378) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 6-hydroxy-4-methyl-5-[2-(3-methylphenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-4-methyl-5-[2-(3-methylphenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117378 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 6-hydroxy-4-methyl-5-[2-(3-methylphenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
| SMILES | Cc1cccc(OCC(=O)c2c(C)c(C#N)c(=O)n(CCCOC(C)C)c2O)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-14(2)28-10-6-9-24-21(26)18(12-23)16(4)20(22(24)27)19(25)13-29-17-8-5-7-15(3)11-17/h5,7-8,11,14,27H,6,9-10,13H2,1-4H3 |
| InChIKey | VEYQGABTMJSZRX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|