C21H14FN3O5 — CID 19117763
1-[(4-fluorophenyl)methyl]-6-hydroxy-4-methyl-5-(4-nitrobenzoyl)-2-oxopyridine-3-carbonitrile (PubChem CID 19117763) has the molecular formula C21H14FN3O5 and a molecular weight of 407.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-hydroxy-4-methyl-5-(4-nitrobenzoyl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-hydroxy-4-methyl-5-(4-nitrobenzoyl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117763 |
| Molecular Formula | C21H14FN3O5 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-hydroxy-4-methyl-5-(4-nitrobenzoyl)-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)c2ccc([N+](=O)[O-])cc2)c(O)n(Cc2ccc(F)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C21H14FN3O5/c1-12-17(10-23)20(27)24(11-13-2-6-15(22)7-3-13)21(28)18(12)19(26)14-4-8-16(9-5-14)25(29)30/h2-9,28H,11H2,1H3 |
| InChIKey | RHFAJILRCLPFSQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|