C24H26N2O5S — CID 19119128
N-[3-(3-ethoxypropylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]-8-methyl-4-oxochromene-2-carboxamide (PubChem CID 19119128) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]-8-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(3-ethoxypropylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]-8-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 19119128 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[3-(3-ethoxypropylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]-8-methyl-4-oxochromene-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1c(NC(=O)c2cc(=O)c3cccc(C)c3o2)sc2c1CCC2 |
| InChI | InChI=1S/C24H26N2O5S/c1-3-30-12-6-11-25-23(29)20-16-9-5-10-19(16)32-24(20)26-22(28)18-13-17(27)15-8-4-7-14(2)21(15)31-18/h4,7-8,13H,3,5-6,9-12H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | HKZZLHKWSCWSSD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|