C30H30N2O6 — CID 19124800
[2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate (PubChem CID 19124800) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19124800 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4C)ccc32)ccc1OCC(C)C |
| InChI | InChI=1S/C30H30N2O6/c1-18(2)16-35-25-12-9-20(13-27(25)34-4)29-22-11-10-21(14-26(22)38-30(32)23(29)15-31)37-28(33)17-36-24-8-6-5-7-19(24)3/h5-14,18,29H,16-17,32H2,1-4H3 |
| InChIKey | CSAQEFLSIGMSIV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|