C21H28N2O3 — CID 19133305
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N,N-dipropylbenzamide (PubChem CID 19133305) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N,N-dipropylbenzamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 19133305 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(N2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-3-12-22(13-4-2)19(24)15-8-7-9-16(14-15)23-20(25)17-10-5-6-11-18(17)21(23)26/h7-9,14,17-18H,3-6,10-13H2,1-2H3 |
| InChIKey | YSMXJGZWGXHCAV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|