C30H30N2O5 — CID 19134194
13-(4-ethoxyphenyl)-14-(3-morpholin-4-ylpropyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 19134194) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 13-(4-ethoxyphenyl)-14-(3-morpholin-4-ylpropyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 13-(4-ethoxyphenyl)-14-(3-morpholin-4-ylpropyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 19134194 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 13-(4-ethoxyphenyl)-14-(3-morpholin-4-ylpropyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | CCOc1ccc(C2c3c(oc4c(ccc5ccccc54)c3=O)C(=O)N2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-2-36-22-11-8-21(9-12-22)26-25-27(33)24-13-10-20-6-3-4-7-23(20)28(24)37-29(25)30(34)32(26)15-5-14-31-16-18-35-19-17-31/h3-4,6-13,26H,2,5,14-19H2,1H3 |
| InChIKey | IIWAAOQRPLEYEE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|