C22H29N5 — CID 19143479
4-N-(1-adamantyl)-6-N-[(4-methylphenyl)methyl]pyrimidine-4,5,6-triamine (PubChem CID 19143479) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-[(4-methylphenyl)methyl]pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-[(4-methylphenyl)methyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143479 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-[(4-methylphenyl)methyl]pyrimidine-4,5,6-triamine |
| SMILES | Cc1ccc(CNc2ncnc(NC34CC5CC(CC(C5)C3)C4)c2N)cc1 |
| InChI | InChI=1S/C22H29N5/c1-14-2-4-15(5-3-14)12-24-20-19(23)21(26-13-25-20)27-22-9-16-6-17(10-22)8-18(7-16)11-22/h2-5,13,16-18H,6-12,23H2,1H3,(H2,24,25,26,27) |
| InChIKey | LNHBBDLLDLTQGW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |