C18H17N7S — CID 19144343
4-N-(4-methyl-1,3-benzothiazol-2-yl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19144343) has the molecular formula C18H17N7S and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-N-(4-methyl-1,3-benzothiazol-2-yl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(4-methyl-1,3-benzothiazol-2-yl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19144343 |
| Molecular Formula | C18H17N7S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-N-(4-methyl-1,3-benzothiazol-2-yl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | Cc1cccc2sc(Nc3ncnc(NNc4ccccc4)c3N)nc12 |
| InChI | InChI=1S/C18H17N7S/c1-11-6-5-9-13-15(11)22-18(26-13)23-16-14(19)17(21-10-20-16)25-24-12-7-3-2-4-8-12/h2-10,24H,19H2,1H3,(H2,20,21,22,23,25) |
| InChIKey | YUVHNIRCPHTTOA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|