C14H14N6 — CID 19145042
6-hydrazinyl-4-N-naphthalen-1-ylpyrimidine-4,5-diamine (PubChem CID 19145042) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-naphthalen-1-ylpyrimidine-4,5-diamine.
| Compound Name | 6-hydrazinyl-4-N-naphthalen-1-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19145042 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-hydrazinyl-4-N-naphthalen-1-ylpyrimidine-4,5-diamine |
| SMILES | NNc1ncnc(Nc2cccc3ccccc23)c1N |
| InChI | InChI=1S/C14H14N6/c15-12-13(17-8-18-14(12)20-16)19-11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,15-16H2,(H2,17,18,19,20) |
| InChIKey | PSKXLWWWOZABSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|