C17H25N5 — CID 19145751
6-N-(3-methylbutyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine (PubChem CID 19145751) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-N-(3-methylbutyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(3-methylbutyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19145751 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 6-N-(3-methylbutyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine |
| SMILES | CC(C)CCNc1ncnc(NC(C)c2ccccc2)c1N |
| InChI | InChI=1S/C17H25N5/c1-12(2)9-10-19-16-15(18)17(21-11-20-16)22-13(3)14-7-5-4-6-8-14/h4-8,11-13H,9-10,18H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | NCJKSWRCRAOVNQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |