About 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine
6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine (PubChem CID 19147565) has the molecular formula C13H11N5S2
and a molecular weight of 301.40 g/mol. Its IUPAC name is 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine |
| PubChem CID | 19147565 |
| Molecular Formula | C13H11N5S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2nccs2)ncnc1Sc1ccccc1 |
| InChI | InChI=1S/C13H11N5S2/c14-10-11(18-13-15-6-7-19-13)16-8-17-12(10)20-9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16,17,18) |
| InChIKey | XYSXXCDMQAHAPC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine?
The IUPAC name of 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine (CID 19147565) is 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine.
What is the SMILES notation for 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine?
The canonical SMILES for 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine is Nc1c(Nc2nccs2)ncnc1Sc1ccccc1.
What is the InChIKey of 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine?
The InChIKey is XYSXXCDMQAHAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5S2/c14-10-11(18-13-15-6-7-19-13)16-8-17-12(10)20-9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16,17,18).
What are the key properties of 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine?
6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine has a molecular weight of 301.40 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylsulfanyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5-diamine is sourced from PubChem (CID 19147565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).