C17H12Cl2N6 — CID 19149882
6-(benzimidazol-1-yl)-4-N-(2,4-dichlorophenyl)pyrimidine-4,5-diamine (PubChem CID 19149882) has the molecular formula C17H12Cl2N6 and a molecular weight of 371.23 g/mol. Its IUPAC name is 6-(benzimidazol-1-yl)-4-N-(2,4-dichlorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(benzimidazol-1-yl)-4-N-(2,4-dichlorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19149882 |
| Molecular Formula | C17H12Cl2N6 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 6-(benzimidazol-1-yl)-4-N-(2,4-dichlorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(Cl)cc2Cl)ncnc1-n1cnc2ccccc21 |
| InChI | InChI=1S/C17H12Cl2N6/c18-10-5-6-12(11(19)7-10)24-16-15(20)17(22-8-21-16)25-9-23-13-3-1-2-4-14(13)25/h1-9H,20H2,(H,21,22,24) |
| InChIKey | BAGQMPPUSATHNS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |