About 2-amino-5-sulfobenzoic acid
2-amino-5-sulfobenzoic acid (PubChem CID 19151) has the molecular formula C7H7NO5S
and a molecular weight of 217.20 g/mol. Its IUPAC name is 2-amino-5-sulfobenzoic acid.
Molecular Properties
| Compound Name | 2-amino-5-sulfobenzoic acid |
| PubChem CID | 19151 |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2-amino-5-sulfobenzoic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C7H7NO5S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3H,8H2,(H,9,10)(H,11,12,13) |
| InChIKey | MJNYPLCGWXFYPD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-sulfobenzoic acid?
The IUPAC name of 2-amino-5-sulfobenzoic acid (CID 19151) is 2-amino-5-sulfobenzoic acid.
What is the SMILES notation for 2-amino-5-sulfobenzoic acid?
The canonical SMILES for 2-amino-5-sulfobenzoic acid is Nc1ccc(S(=O)(=O)O)cc1C(=O)O.
What is the InChIKey of 2-amino-5-sulfobenzoic acid?
The InChIKey is MJNYPLCGWXFYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3H,8H2,(H,9,10)(H,11,12,13).
What are the key properties of 2-amino-5-sulfobenzoic acid?
2-amino-5-sulfobenzoic acid has a molecular weight of 217.20 g/mol, XLogP of 0.21, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-sulfobenzoic acid is sourced from PubChem (CID 19151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).