C12H12F2N4O — CID 19152457
4-N-(2,5-difluorophenyl)-6-ethoxypyrimidine-4,5-diamine (PubChem CID 19152457) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-N-(2,5-difluorophenyl)-6-ethoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(2,5-difluorophenyl)-6-ethoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19152457 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-N-(2,5-difluorophenyl)-6-ethoxypyrimidine-4,5-diamine |
| SMILES | CCOc1ncnc(Nc2cc(F)ccc2F)c1N |
| InChI | InChI=1S/C12H12F2N4O/c1-2-19-12-10(15)11(16-6-17-12)18-9-5-7(13)3-4-8(9)14/h3-6H,2,15H2,1H3,(H,16,17,18) |
| InChIKey | DKXVNBNRGKZKED-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |