About 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one
5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one (PubChem CID 19152716) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one |
| PubChem CID | 19152716 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2nc[nH]c(=O)c2N)cc1C |
| InChI | InChI=1S/C12H13N3O2/c1-7-3-4-9(5-8(7)2)17-12-10(13)11(16)14-6-15-12/h3-6H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | VWXODNDVAJBTNY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one (CID 19152716) is 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one is Cc1ccc(Oc2nc[nH]c(=O)c2N)cc1C.
What is the InChIKey of 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one?
The InChIKey is VWXODNDVAJBTNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-7-3-4-9(5-8(7)2)17-12-10(13)11(16)14-6-15-12/h3-6H,13H2,1-2H3,(H,14,15,16).
What are the key properties of 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one?
5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one has a molecular weight of 231.25 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(3,4-dimethylphenoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 19152716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).