C12H23N5O2 — CID 19154117
4-N,6-N-bis(1-methoxypropan-2-yl)pyrimidine-4,5,6-triamine (PubChem CID 19154117) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-N,6-N-bis(1-methoxypropan-2-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-bis(1-methoxypropan-2-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19154117 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-N,6-N-bis(1-methoxypropan-2-yl)pyrimidine-4,5,6-triamine |
| SMILES | COCC(C)Nc1ncnc(NC(C)COC)c1N |
| InChI | InChI=1S/C12H23N5O2/c1-8(5-18-3)16-11-10(13)12(15-7-14-11)17-9(2)6-19-4/h7-9H,5-6,13H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | AKPUPGQPDDQPDH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |