C23H29N3O2 — CID 19154676
(1-methylpiperidin-4-yl) 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate (PubChem CID 19154676) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate.
| Compound Name | (1-methylpiperidin-4-yl) 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 19154676 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (1-methylpiperidin-4-yl) 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
| SMILES | CN1CCC(OC(=O)C23CCC(C)(c4nc5ccccc5nc42)C3(C)C)CC1 |
| InChI | InChI=1S/C23H29N3O2/c1-21(2)22(3)11-12-23(21,20(27)28-15-9-13-26(4)14-10-15)19-18(22)24-16-7-5-6-8-17(16)25-19/h5-8,15H,9-14H2,1-4H3 |
| InChIKey | OHJXPKAIIXGAPL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |