C22H20N2O5 — CID 19158884
(4-methylphenyl) (4E)-4-(furan-2-carbonylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19158884) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is (4-methylphenyl) (4E)-4-(furan-2-carbonylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (4-methylphenyl) (4E)-4-(furan-2-carbonylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19158884 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (4-methylphenyl) (4E)-4-(furan-2-carbonylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2oc3c(c2C)/C(=N/NC(=O)c2ccco2)CCC3)cc1 |
| InChI | InChI=1S/C22H20N2O5/c1-13-8-10-15(11-9-13)28-22(26)20-14(2)19-16(5-3-6-17(19)29-20)23-24-21(25)18-7-4-12-27-18/h4,7-12H,3,5-6H2,1-2H3,(H,24,25)/b23-16+ |
| InChIKey | YWIRRFANRJDUQJ-XQNSMLJCSA-N |
| XLogP | 4.18 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|