C23H22N4O5 — CID 19160042
N-[(E)-[2-[(furan-2-carbonylamino)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-phenylacetamide (PubChem CID 19160042) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[(E)-[2-[(furan-2-carbonylamino)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-phenylacetamide.
| Compound Name | N-[(E)-[2-[(furan-2-carbonylamino)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 19160042 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[(E)-[2-[(furan-2-carbonylamino)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-phenylacetamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccco2)oc2c1/C(=N/NC(=O)Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C23H22N4O5/c1-14-20-16(24-25-19(28)13-15-7-3-2-4-8-15)9-5-10-17(20)32-21(14)23(30)27-26-22(29)18-11-6-12-31-18/h2-4,6-8,11-12H,5,9-10,13H2,1H3,(H,25,28)(H,26,29)(H,27,30)/b24-16+ |
| InChIKey | RMKVKQJGVDFXCW-LFVJCYFKSA-N |
| XLogP | 2.66 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|