C27H24N4O4 — CID 19160241
(4E)-3-methyl-4-[(2-phenoxyacetyl)hydrazinylidene]-N-quinolin-5-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160241) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is (4E)-3-methyl-4-[(2-phenoxyacetyl)hydrazinylidene]-N-quinolin-5-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-3-methyl-4-[(2-phenoxyacetyl)hydrazinylidene]-N-quinolin-5-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160241 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (4E)-3-methyl-4-[(2-phenoxyacetyl)hydrazinylidene]-N-quinolin-5-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc3ncccc23)oc2c1/C(=N/NC(=O)COc1ccccc1)CCC2 |
| InChI | InChI=1S/C27H24N4O4/c1-17-25-22(30-31-24(32)16-34-18-8-3-2-4-9-18)13-6-14-23(25)35-26(17)27(33)29-21-12-5-11-20-19(21)10-7-15-28-20/h2-5,7-12,15H,6,13-14,16H2,1H3,(H,29,33)(H,31,32)/b30-22+ |
| InChIKey | GSKPSOAECVBALX-JBASAIQMSA-N |
| XLogP | 4.62 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|