C18H20F7N3O3 — CID 19160928
(4E)-N-butan-2-yl-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160928) has the molecular formula C18H20F7N3O3 and a molecular weight of 459.36 g/mol. Its IUPAC name is (4E)-N-butan-2-yl-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-butan-2-yl-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160928 |
| Molecular Formula | C18H20F7N3O3 |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (4E)-N-butan-2-yl-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1oc2c(c1C)/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C18H20F7N3O3/c1-4-8(2)26-14(29)13-9(3)12-10(6-5-7-11(12)31-13)27-28-15(30)16(19,20)17(21,22)18(23,24)25/h8H,4-7H2,1-3H3,(H,26,29)(H,28,30)/b27-10+ |
| InChIKey | LLUPMRMSGGTJSP-YPXUMCKCSA-N |
| XLogP | 4.11 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|