C20H22F7N3O3 — CID 19160932
2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperidine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide (PubChem CID 19160932) has the molecular formula C20H22F7N3O3 and a molecular weight of 485.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperidine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperidine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
|---|---|
| PubChem CID | 19160932 |
| Molecular Formula | C20H22F7N3O3 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperidine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
| SMILES | Cc1c(C(=O)N2CCC(C)CC2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C20H22F7N3O3/c1-10-6-8-30(9-7-10)16(31)15-11(2)14-12(4-3-5-13(14)33-15)28-29-17(32)18(21,22)19(23,24)20(25,26)27/h10H,3-9H2,1-2H3,(H,29,32)/b28-12+ |
| InChIKey | KSPZLTZIXDRIRL-KVSWJAHQSA-N |
| XLogP | 4.45 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|