C17H18F7N3O3 — CID 19160982
(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-propyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160982) has the molecular formula C17H18F7N3O3 and a molecular weight of 445.34 g/mol. Its IUPAC name is (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-propyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-propyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160982 |
| Molecular Formula | C17H18F7N3O3 |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-propyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | CCCNC(=O)c1oc2c(c1C)/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C17H18F7N3O3/c1-3-7-25-13(28)12-8(2)11-9(5-4-6-10(11)30-12)26-27-14(29)15(18,19)16(20,21)17(22,23)24/h3-7H2,1-2H3,(H,25,28)(H,27,29)/b26-9+ |
| InChIKey | RHPATSCLRWNUFK-JQAMDZJQSA-N |
| XLogP | 3.72 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|