C16H16F7N3O3 — CID 19160988
(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,N,3-trimethyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160988) has the molecular formula C16H16F7N3O3 and a molecular weight of 431.31 g/mol. Its IUPAC name is (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,N,3-trimethyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,N,3-trimethyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160988 |
| Molecular Formula | C16H16F7N3O3 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,N,3-trimethyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C16H16F7N3O3/c1-7-10-8(5-4-6-9(10)29-11(7)12(27)26(2)3)24-25-13(28)14(17,18)15(19,20)16(21,22)23/h4-6H2,1-3H3,(H,25,28)/b24-8+ |
| InChIKey | SCSPLLKXUIETES-KTZMUZOWSA-N |
| XLogP | 3.28 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|