C19H21F7N4O3 — CID 19160995
2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperazine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide (PubChem CID 19160995) has the molecular formula C19H21F7N4O3 and a molecular weight of 486.39 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperazine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperazine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
|---|---|
| PubChem CID | 19160995 |
| Molecular Formula | C19H21F7N4O3 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-(4-methylpiperazine-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
| SMILES | Cc1c(C(=O)N2CCN(C)CC2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C19H21F7N4O3/c1-10-13-11(27-28-16(32)17(20,21)18(22,23)19(24,25)26)4-3-5-12(13)33-14(10)15(31)30-8-6-29(2)7-9-30/h3-9H2,1-2H3,(H,28,32)/b27-11+ |
| InChIKey | IKSUUEWCERYNJT-LUOAPIJWSA-N |
| XLogP | 2.97 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|