C18H18N4O4S — CID 19162134
(4E)-N-(1,3-benzodioxol-5-yl)-4-(carbamothioylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19162134) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is (4E)-N-(1,3-benzodioxol-5-yl)-4-(carbamothioylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(1,3-benzodioxol-5-yl)-4-(carbamothioylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19162134 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (4E)-N-(1,3-benzodioxol-5-yl)-4-(carbamothioylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc3c(c2)OCO3)oc2c1/C(=N/NC(N)=S)CCC2 |
| InChI | InChI=1S/C18H18N4O4S/c1-9-15-11(21-22-18(19)27)3-2-4-13(15)26-16(9)17(23)20-10-5-6-12-14(7-10)25-8-24-12/h5-7H,2-4,8H2,1H3,(H,20,23)(H3,19,22,27)/b21-11+ |
| InChIKey | BWZSQQALSMVKDF-SRZZPIQSSA-N |
| XLogP | 2.44 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|