C12H7Cl6N3O — CID 19163
2-(4-methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 19163) has the molecular formula C12H7Cl6N3O and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(4-methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 19163 |
| Molecular Formula | C12H7Cl6N3O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 418.87 |
| IUPAC Name | 2-(4-methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C12H7Cl6N3O/c1-22-7-4-2-6(3-5-7)8-19-9(11(13,14)15)21-10(20-8)12(16,17)18/h2-5H,1H3 |
| InChIKey | QRHHZFRCJDAUNA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|