C23H27N7 — CID 19163857
5-butyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 19163857) has the molecular formula C23H27N7 and a molecular weight of 401.52 g/mol. Its IUPAC name is 5-butyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-butyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 19163857 |
| Molecular Formula | C23H27N7 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 5-butyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCn1c2ccc(C)cc2c2nnc(N/N=C/c3ccc(N(C)C)cc3)nc21 |
| InChI | InChI=1S/C23H27N7/c1-5-6-13-30-20-12-7-16(2)14-19(20)21-22(30)25-23(28-26-21)27-24-15-17-8-10-18(11-9-17)29(3)4/h7-12,14-15H,5-6,13H2,1-4H3,(H,25,27,28)/b24-15+ |
| InChIKey | SPLYKNNQQPZPTI-BUVRLJJBSA-N |
| XLogP | 4.60 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|