C18H15Cl3N2O3 — CID 19167523
(E)-N'-[2-(4-chloro-3-methylphenoxy)acetyl]-3-(2,4-dichlorophenyl)prop-2-enehydrazide (PubChem CID 19167523) has the molecular formula C18H15Cl3N2O3 and a molecular weight of 413.69 g/mol. Its IUPAC name is (E)-N'-[2-(4-chloro-3-methylphenoxy)acetyl]-3-(2,4-dichlorophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-chloro-3-methylphenoxy)acetyl]-3-(2,4-dichlorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 19167523 |
| Molecular Formula | C18H15Cl3N2O3 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (E)-N'-[2-(4-chloro-3-methylphenoxy)acetyl]-3-(2,4-dichlorophenyl)prop-2-enehydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)/C=C/c2ccc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C18H15Cl3N2O3/c1-11-8-14(5-6-15(11)20)26-10-18(25)23-22-17(24)7-3-12-2-4-13(19)9-16(12)21/h2-9H,10H2,1H3,(H,22,24)(H,23,25)/b7-3+ |
| InChIKey | MMPOGZOIAHWXRP-XVNBXDOJSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|