C21H24N2O5 — CID 19167688
(E)-3-(2,5-dimethoxyphenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 19167688) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 19167688 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NNC(=O)COc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-14-9-15(2)11-18(10-14)28-13-21(25)23-22-20(24)8-5-16-12-17(26-3)6-7-19(16)27-4/h5-12H,13H2,1-4H3,(H,22,24)(H,23,25)/b8-5+ |
| InChIKey | NJRYTLPBSLTKLU-VMPITWQZSA-N |
| XLogP | 2.56 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|