About 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione
2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione (PubChem CID 19167926) has the molecular formula C15H13NO5
and a molecular weight of 287.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione |
| PubChem CID | 19167926 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione |
| SMILES | CN1C(=O)C(=C2C(=O)OC(C)(C)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H13NO5/c1-15(2)20-13(18)11(14(19)21-15)10-8-6-4-5-7-9(8)16(3)12(10)17/h4-7H,1-3H3 |
| InChIKey | YURUBYKSNBHFRF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione?
The IUPAC name of 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione (CID 19167926) is 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione.
What is the SMILES notation for 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione?
The canonical SMILES for 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione is CN1C(=O)C(=C2C(=O)OC(C)(C)OC2=O)c2ccccc21.
What is the InChIKey of 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione?
The InChIKey is YURUBYKSNBHFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO5/c1-15(2)20-13(18)11(14(19)21-15)10-8-6-4-5-7-9(8)16(3)12(10)17/h4-7H,1-3H3.
What are the key properties of 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione?
2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione has a molecular weight of 287.27 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-(1-methyl-2-oxoindol-3-ylidene)-1,3-dioxane-4,6-dione is sourced from PubChem (CID 19167926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).