About 2-nitroanthracene
2-nitroanthracene (PubChem CID 19168) has the molecular formula C14H9NO2
and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-nitroanthracene.
Molecular Properties
| Compound Name | 2-nitroanthracene |
| PubChem CID | 19168 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-nitroanthracene |
| SMILES | O=[N+]([O-])c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H9NO2/c16-15(17)14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
| InChIKey | NZWGQBVOKHEKLD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroanthracene?
The IUPAC name of 2-nitroanthracene (CID 19168) is 2-nitroanthracene.
What is the SMILES notation for 2-nitroanthracene?
The canonical SMILES for 2-nitroanthracene is O=[N+]([O-])c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of 2-nitroanthracene?
The InChIKey is NZWGQBVOKHEKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2/c16-15(17)14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H.
What are the key properties of 2-nitroanthracene?
2-nitroanthracene has a molecular weight of 223.23 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroanthracene is sourced from PubChem (CID 19168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).