C17H13IN2O2 — CID 19168661
(E)-2-cyano-N-(4-iodophenyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 19168661) has the molecular formula C17H13IN2O2 and a molecular weight of 404.21 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-iodophenyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-iodophenyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19168661 |
| Molecular Formula | C17H13IN2O2 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | (E)-2-cyano-N-(4-iodophenyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C17H13IN2O2/c1-22-16-8-2-12(3-9-16)10-13(11-19)17(21)20-15-6-4-14(18)5-7-15/h2-10H,1H3,(H,20,21)/b13-10+ |
| InChIKey | DSJVNBJUZGCDAN-JLHYYAGUSA-N |
| XLogP | 3.85 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|