About 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate
3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate (PubChem CID 19169490) has the molecular formula C20H22N2O6
and a molecular weight of 386.40 g/mol. Its IUPAC name is 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate.
Molecular Properties
| Compound Name | 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate |
| PubChem CID | 19169490 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate |
| SMILES | CC(C)CCOC(=O)c1ccc(NC(=O)COc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-14(2)11-12-27-20(24)15-7-9-16(10-8-15)21-19(23)13-28-18-6-4-3-5-17(18)22(25)26/h3-10,14H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | YPXUDJGYZOBHLG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate?
The IUPAC name of 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate (CID 19169490) is 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate.
What is the SMILES notation for 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate?
The canonical SMILES for 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate is CC(C)CCOC(=O)c1ccc(NC(=O)COc2ccccc2[N+](=O)[O-])cc1.
What is the InChIKey of 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate?
The InChIKey is YPXUDJGYZOBHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O6/c1-14(2)11-12-27-20(24)15-7-9-16(10-8-15)21-19(23)13-28-18-6-4-3-5-17(18)22(25)26/h3-10,14H,11-13H2,1-2H3,(H,21,23).
What are the key properties of 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate?
3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate has a molecular weight of 386.40 g/mol, XLogP of 3.82, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 4-[[2-(2-nitrophenoxy)acetyl]amino]benzoate is sourced from PubChem (CID 19169490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).