About sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate
sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate (PubChem CID 19169581) has the molecular formula C12H9NaO4
and a molecular weight of 240.19 g/mol. Its IUPAC name is sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate.
Molecular Properties
| Compound Name | sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate |
| PubChem CID | 19169581 |
| Molecular Formula | C12H9NaO4 |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate |
| SMILES | CCOC(=O)[C-]1C(=O)c2ccccc2C1=O.[Na+] |
| InChI | InChI=1S/C12H9O4.Na/c1-2-16-12(15)9-10(13)7-5-3-4-6-8(7)11(9)14;/h3-6H,2H2,1H3;/q-1;+1 |
| InChIKey | ZLQCEARDLKRSMZ-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate?
The IUPAC name of sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate (CID 19169581) is sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate.
What is the SMILES notation for sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate?
The canonical SMILES for sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate is CCOC(=O)[C-]1C(=O)c2ccccc2C1=O.[Na+].
What is the InChIKey of sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate?
The InChIKey is ZLQCEARDLKRSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O4.Na/c1-2-16-12(15)9-10(13)7-5-3-4-6-8(7)11(9)14;/h3-6H,2H2,1H3;/q-1;+1.
What are the key properties of sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate?
sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate has a molecular weight of 240.19 g/mol, XLogP of -1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium ethyl 1,3-dioxoinden-2-ide-2-carboxylate is sourced from PubChem (CID 19169581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).