About 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione
8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 1917) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 1917 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C3CCCC3)nc2n(C)c1=O |
| InChI | InChI=1S/C12H16N4O2/c1-15-10-8(11(17)16(2)12(15)18)13-9(14-10)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | SCVHFRLUNIOSGI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione (CID 1917) is 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(C3CCCC3)nc2n(C)c1=O.
What is the InChIKey of 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is SCVHFRLUNIOSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2/c1-15-10-8(11(17)16(2)12(15)18)13-9(14-10)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione?
8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 248.29 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 1917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).