C20H24ClN — CID 19171
3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,N-dimethylpropan-1-amine (PubChem CID 19171) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is 3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 19171 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H24ClN/c1-22(2)13-5-8-19-18-7-4-3-6-15(18)9-10-16-11-12-17(21)14-20(16)19/h3-4,6-7,11-12,14,19H,5,8-10,13H2,1-2H3 |
| InChIKey | QWPRVBPBGKAFAL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |