C20H16ClF3N2O3 — CID 19172881
(E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19172881) has the molecular formula C20H16ClF3N2O3 and a molecular weight of 424.81 g/mol. Its IUPAC name is (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19172881 |
| Molecular Formula | C20H16ClF3N2O3 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C20H16ClF3N2O3/c1-3-29-17-7-4-12(9-18(17)28-2)8-13(11-25)19(27)26-14-5-6-16(21)15(10-14)20(22,23)24/h4-10H,3H2,1-2H3,(H,26,27)/b13-8+ |
| InChIKey | MQPUAEALEANZIG-MDWZMJQESA-N |
| XLogP | 5.31 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|