About (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate
(4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 19173417) has the molecular formula C21H20N2O6
and a molecular weight of 396.40 g/mol. Its IUPAC name is (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 19173417 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C)(C)c1ccc(OC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O6/c1-21(2,3)13-7-9-14(10-8-13)29-17(24)11-12-22-19(25)15-5-4-6-16(23(27)28)18(15)20(22)26/h4-10H,11-12H2,1-3H3 |
| InChIKey | UACQQOQCRWNRMW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (CID 19173417) is (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is CC(C)(C)c1ccc(OC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1.
What is the InChIKey of (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is UACQQOQCRWNRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O6/c1-21(2,3)13-7-9-14(10-8-13)29-17(24)11-12-22-19(25)15-5-4-6-16(23(27)28)18(15)20(22)26/h4-10H,11-12H2,1-3H3.
What are the key properties of (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate?
(4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 396.40 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl) 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 19173417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).